C25H18N4O5 — CID 3791966
[4-[[(2-pyrrol-1-ylbenzoyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 3791966) has the molecular formula C25H18N4O5 and a molecular weight of 454.44 g/mol. Its IUPAC name is [4-[[(2-pyrrol-1-ylbenzoyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [4-[[(2-pyrrol-1-ylbenzoyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 3791966 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [4-[[(2-pyrrol-1-ylbenzoyl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)c2ccccc2-n2cccc2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H18N4O5/c30-24(22-8-1-2-9-23(22)28-14-3-4-15-28)27-26-17-18-10-12-21(13-11-18)34-25(31)19-6-5-7-20(16-19)29(32)33/h1-17H,(H,27,30) |
| InChIKey | ZOEDVJUHSOOYPM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|