C24H19N3O5S — CID 97267309
[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate (PubChem CID 97267309) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate.
| Compound Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97267309 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] (3R)-5-oxo-1-phenylpyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1ccccc1NC1=NS(=O)(=O)c2ccccc21)[C@@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C24H19N3O5S/c28-22-14-16(15-27(22)17-8-2-1-3-9-17)24(29)32-20-12-6-5-11-19(20)25-23-18-10-4-7-13-21(18)33(30,31)26-23/h1-13,16H,14-15H2,(H,25,26)/t16-/m1/s1 |
| InChIKey | UXQVOXJQEXTVNM-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|