C19H19NO4 — CID 9057233
(2-methoxyphenyl) (3R)-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057233) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2-methoxyphenyl) (3R)-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-methoxyphenyl) (3R)-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057233 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2-methoxyphenyl) (3R)-1-(3-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1OC(=O)[C@@H]1CC(=O)N(c2cccc(C)c2)C1 |
| InChI | InChI=1S/C19H19NO4/c1-13-6-5-7-15(10-13)20-12-14(11-18(20)21)19(22)24-17-9-4-3-8-16(17)23-2/h3-10,14H,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | JZQVBTNBGALMJY-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|