C20H19NO5 — CID 9056895
(2-acetylphenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056895) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (2-acetylphenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-acetylphenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056895 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2-acetylphenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cccc(N2C[C@H](C(=O)Oc3ccccc3C(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C20H19NO5/c1-13(22)17-8-3-4-9-18(17)26-20(24)14-10-19(23)21(12-14)15-6-5-7-16(11-15)25-2/h3-9,11,14H,10,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | SKBVODGWBJHTOJ-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|