C12H11N5O4S2 — CID 110193181
N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 110193181) has the molecular formula C12H11N5O4S2 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 110193181 |
| Molecular Formula | C12H11N5O4S2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | COc1nc(OC)nc(SNC2=NS(=O)(=O)c3ccccc32)n1 |
| InChI | InChI=1S/C12H11N5O4S2/c1-20-10-13-11(21-2)15-12(14-10)22-16-9-7-5-3-4-6-8(7)23(18,19)17-9/h3-6H,1-2H3,(H,16,17) |
| InChIKey | LOYKGGUPUAICKI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|