C19H15N3O2S — CID 95572225
N-[(E)-1-naphthalen-2-ylethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 95572225) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[(E)-1-naphthalen-2-ylethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-[(E)-1-naphthalen-2-ylethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 95572225 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[(E)-1-naphthalen-2-ylethylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | C/C(=N\NC1=NS(=O)(=O)c2ccccc21)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15N3O2S/c1-13(15-11-10-14-6-2-3-7-16(14)12-15)20-21-19-17-8-4-5-9-18(17)25(23,24)22-19/h2-12H,1H3,(H,21,22)/b20-13+ |
| InChIKey | HBNUWRGNKANBFT-DEDYPNTBSA-N |
| XLogP | 3.30 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|