C12H8N2O2S — CID 125491611
3-pyridin-2-yl-1,2-benzothiazole 1,1-dioxide (PubChem CID 125491611) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-pyridin-2-yl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 125491611 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3-pyridin-2-yl-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C12H8N2O2S/c15-17(16)11-7-2-1-5-9(11)12(14-17)10-6-3-4-8-13-10/h1-8H |
| InChIKey | ODGSJXYIQJWOFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |