C8H9N3O2S — CID 676521
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine (PubChem CID 676521) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine |
|---|---|
| PubChem CID | 676521 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-1-methylhydrazine |
| SMILES | CN(N)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C8H9N3O2S/c1-11(9)8-6-4-2-3-5-7(6)14(12,13)10-8/h2-5H,9H2,1H3 |
| InChIKey | RQGWZBBWDZAJAK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|