C10H10N4O2S — CID 3141847
3-[amino-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile (PubChem CID 3141847) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-[amino-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile.
| Compound Name | 3-[amino-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 3141847 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-[amino-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile |
| SMILES | N#CCCN(N)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H10N4O2S/c11-6-3-7-14(12)10-8-4-1-2-5-9(8)17(15,16)13-10/h1-2,4-5H,3,7,12H2 |
| InChIKey | LPKMAUQNWZCJKH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|