C11H10BrF3N2O2S — CID 107490216
N-(2-bromoethyl)-1,1-dioxo-N-(2,2,2-trifluoroethyl)-1,2-benzothiazol-3-amine (PubChem CID 107490216) has the molecular formula C11H10BrF3N2O2S and a molecular weight of 371.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-1,1-dioxo-N-(2,2,2-trifluoroethyl)-1,2-benzothiazol-3-amine.
| Compound Name | N-(2-bromoethyl)-1,1-dioxo-N-(2,2,2-trifluoroethyl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 107490216 |
| Molecular Formula | C11H10BrF3N2O2S |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | N-(2-bromoethyl)-1,1-dioxo-N-(2,2,2-trifluoroethyl)-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(N(CCBr)CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C11H10BrF3N2O2S/c12-5-6-17(7-11(13,14)15)10-8-3-1-2-4-9(8)20(18,19)16-10/h1-4H,5-7H2 |
| InChIKey | NMLPLBGLGPFRNM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|