C7H4ClN3O4S — CID 97180591
3-chloro-7-nitro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 97180591) has the molecular formula C7H4ClN3O4S and a molecular weight of 261.65 g/mol. Its IUPAC name is 3-chloro-7-nitro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-chloro-7-nitro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 97180591 |
| Molecular Formula | C7H4ClN3O4S |
| Molecular Weight | 261.65 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 3-chloro-7-nitro-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)N=C(Cl)N2 |
| InChI | InChI=1S/C7H4ClN3O4S/c8-7-9-5-2-1-4(11(12)13)3-6(5)16(14,15)10-7/h1-3H,(H,9,10) |
| InChIKey | WNSZRAMJIPQQBJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.65 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|