C21H18FN5O8S — CID 135446978
6-fluoro-4-hydroxy-1-(3-methylbutyl)-8-nitro-3-(7-nitro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)quinolin-2-one (PubChem CID 135446978) has the molecular formula C21H18FN5O8S and a molecular weight of 519.47 g/mol. Its IUPAC name is 6-fluoro-4-hydroxy-1-(3-methylbutyl)-8-nitro-3-(7-nitro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)quinolin-2-one.
| Compound Name | 6-fluoro-4-hydroxy-1-(3-methylbutyl)-8-nitro-3-(7-nitro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)quinolin-2-one |
|---|---|
| PubChem CID | 135446978 |
| Molecular Formula | C21H18FN5O8S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 6-fluoro-4-hydroxy-1-(3-methylbutyl)-8-nitro-3-(7-nitro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)quinolin-2-one |
| SMILES | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3cc([N+](=O)[O-])ccc3N2)c(O)c2cc(F)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C21H18FN5O8S/c1-10(2)5-6-25-18-13(7-11(22)8-15(18)27(32)33)19(28)17(21(25)29)20-23-14-4-3-12(26(30)31)9-16(14)36(34,35)24-20/h3-4,7-10,28H,5-6H2,1-2H3,(H,23,24) |
| InChIKey | ZLTXRHXVVUDDJX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|