C28H25N5O7S — CID 135493128
N-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1-(3-methylbutyl)-2-oxoquinolin-6-yl]-4-nitrobenzamide (PubChem CID 135493128) has the molecular formula C28H25N5O7S and a molecular weight of 575.60 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1-(3-methylbutyl)-2-oxoquinolin-6-yl]-4-nitrobenzamide.
| Compound Name | N-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1-(3-methylbutyl)-2-oxoquinolin-6-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 135493128 |
| Molecular Formula | C28H25N5O7S |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | N-[3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1-(3-methylbutyl)-2-oxoquinolin-6-yl]-4-nitrobenzamide |
| SMILES | CC(C)CCn1c(=O)c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2cc(NC(=O)c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C28H25N5O7S/c1-16(2)13-14-32-22-12-9-18(29-27(35)17-7-10-19(11-8-17)33(37)38)15-20(22)25(34)24(28(32)36)26-30-21-5-3-4-6-23(21)41(39,40)31-26/h3-12,15-16,34H,13-14H2,1-2H3,(H,29,35)(H,30,31) |
| InChIKey | NTCMRWYAHJYUQE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 173.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|