C13H9N3O4S — CID 3624238
3-(3-nitrophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 3624238) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-(3-nitrophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 3624238 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-(3-nitrophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=[N+]([O-])c1cccc(C2=NS(=O)(=O)c3ccccc3N2)c1 |
| InChI | InChI=1S/C13H9N3O4S/c17-16(18)10-5-3-4-9(8-10)13-14-11-6-1-2-7-12(11)21(19,20)15-13/h1-8H,(H,14,15) |
| InChIKey | OLNXOMLQDYVLSZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|