C21H15N5O6 — CID 13235433
2,4,5-tris(3-nitrophenyl)-4,5-dihydro-1H-imidazole (PubChem CID 13235433) has the molecular formula C21H15N5O6 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2,4,5-tris(3-nitrophenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2,4,5-tris(3-nitrophenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 13235433 |
| Molecular Formula | C21H15N5O6 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2,4,5-tris(3-nitrophenyl)-4,5-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])c1cccc(C2=NC(c3cccc([N+](=O)[O-])c3)C(c3cccc([N+](=O)[O-])c3)N2)c1 |
| InChI | InChI=1S/C21H15N5O6/c27-24(28)16-7-1-4-13(10-16)19-20(14-5-2-8-17(11-14)25(29)30)23-21(22-19)15-6-3-9-18(12-15)26(31)32/h1-12,19-20H,(H,22,23) |
| InChIKey | FBMSEYNEDREPIQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|