C11H13ClN2O4S — CID 70237924
2-(2-chloroethyl)-3,3-dimethyl-6-nitro-1,2-benzothiazole 1,1-dioxide (PubChem CID 70237924) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3,3-dimethyl-6-nitro-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2-(2-chloroethyl)-3,3-dimethyl-6-nitro-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 70237924 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-(2-chloroethyl)-3,3-dimethyl-6-nitro-1,2-benzothiazole 1,1-dioxide |
| SMILES | CC1(C)c2ccc([N+](=O)[O-])cc2S(=O)(=O)N1CCCl |
| InChI | InChI=1S/C11H13ClN2O4S/c1-11(2)9-4-3-8(14(15)16)7-10(9)19(17,18)13(11)6-5-12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PHXZTNABPCJOFZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|