C13H9NO6S2 — CID 154173193
2-methyl-8-nitrothianthrene 5,5,10,10-tetraoxide (PubChem CID 154173193) has the molecular formula C13H9NO6S2 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-methyl-8-nitrothianthrene 5,5,10,10-tetraoxide.
| Compound Name | 2-methyl-8-nitrothianthrene 5,5,10,10-tetraoxide |
|---|---|
| PubChem CID | 154173193 |
| Molecular Formula | C13H9NO6S2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2-methyl-8-nitrothianthrene 5,5,10,10-tetraoxide |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)c1cc([N+](=O)[O-])ccc1S2(=O)=O |
| InChI | InChI=1S/C13H9NO6S2/c1-8-2-4-10-12(6-8)22(19,20)13-7-9(14(15)16)3-5-11(13)21(10,17)18/h2-7H,1H3 |
| InChIKey | UMQVTWRKDXWZMC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|