C21H12ClN3O6S — CID 98196473
(4aR,9aR)-1-chloro-2-[(6-nitro-1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 98196473) has the molecular formula C21H12ClN3O6S and a molecular weight of 469.86 g/mol. Its IUPAC name is (4aR,9aR)-1-chloro-2-[(6-nitro-1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | (4aR,9aR)-1-chloro-2-[(6-nitro-1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 98196473 |
| Molecular Formula | C21H12ClN3O6S |
| Molecular Weight | 469.86 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | (4aR,9aR)-1-chloro-2-[(6-nitro-1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)[C@@H]2C=CC(NC3=NS(=O)(=O)c4cc([N+](=O)[O-])ccc43)=C(Cl)[C@@H]12 |
| InChI | InChI=1S/C21H12ClN3O6S/c22-18-15(8-7-14-17(18)20(27)12-4-2-1-3-11(12)19(14)26)23-21-13-6-5-10(25(28)29)9-16(13)32(30,31)24-21/h1-9,14,17H,(H,23,24)/t14-,17+/m1/s1 |
| InChIKey | XCYXJSNBCYENDD-PBHICJAKSA-N |
| XLogP | 2.97 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|