C26H18N4O14S4-2 — CID 21065044
5-[(3-nitrophenyl)sulfonylamino]-2-[(E)-2-[4-[(3-nitrophenyl)sulfonylamino]-2-sulfonatophenyl]ethenyl]benzenesulfonate (PubChem CID 21065044) has the molecular formula C26H18N4O14S4-2 and a molecular weight of 738.71 g/mol. Its IUPAC name is 5-[(3-nitrophenyl)sulfonylamino]-2-[(E)-2-[4-[(3-nitrophenyl)sulfonylamino]-2-sulfonatophenyl]ethenyl]benzenesulfonate.
| Compound Name | 5-[(3-nitrophenyl)sulfonylamino]-2-[(E)-2-[4-[(3-nitrophenyl)sulfonylamino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 21065044 |
| Molecular Formula | C26H18N4O14S4-2 |
| Molecular Weight | 738.71 g/mol |
| Exact Mass | 737.97 |
| IUPAC Name | 5-[(3-nitrophenyl)sulfonylamino]-2-[(E)-2-[4-[(3-nitrophenyl)sulfonylamino]-2-sulfonatophenyl]ethenyl]benzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(/C=C/c3ccc(NS(=O)(=O)c4cccc([N+](=O)[O-])c4)cc3S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H20N4O14S4/c31-29(32)21-3-1-5-23(15-21)45(35,36)27-19-11-9-17(25(13-19)47(39,40)41)7-8-18-10-12-20(14-26(18)48(42,43)44)28-46(37,38)24-6-2-4-22(16-24)30(33)34/h1-16,27-28H,(H,39,40,41)(H,42,43,44)/p-2/b8-7+ |
| InChIKey | HFZAJEDUTKJPEE-BQYQJAHWSA-L |
| XLogP | 3.08 |
| TPSA | 293.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|