C26H19N7O11S3 — CID 134867953
6-amino-7-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]diazenyl]-2-phenylbenzotriazole-5-sulfonic acid (PubChem CID 134867953) has the molecular formula C26H19N7O11S3 and a molecular weight of 701.68 g/mol. Its IUPAC name is 6-amino-7-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]diazenyl]-2-phenylbenzotriazole-5-sulfonic acid.
| Compound Name | 6-amino-7-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]diazenyl]-2-phenylbenzotriazole-5-sulfonic acid |
|---|---|
| PubChem CID | 134867953 |
| Molecular Formula | C26H19N7O11S3 |
| Molecular Weight | 701.68 g/mol |
| Exact Mass | 701.03 |
| IUPAC Name | 6-amino-7-[[4-[(E)-2-(4-nitro-2-sulfophenyl)ethenyl]-3-sulfophenyl]diazenyl]-2-phenylbenzotriazole-5-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc2nn(-c3ccccc3)nc2c1/N=N/c1ccc(/C=C/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H19N7O11S3/c27-24-23(47(42,43)44)14-20-25(31-32(30-20)18-4-2-1-3-5-18)26(24)29-28-17-10-8-15(21(12-17)45(36,37)38)6-7-16-9-11-19(33(34)35)13-22(16)46(39,40)41/h1-14H,27H2,(H,36,37,38)(H,39,40,41)(H,42,43,44)/b7-6+,29-28+ |
| InChIKey | FCUALEOPILFEPT-FUDFVLGMSA-N |
| XLogP | 4.24 |
| TPSA | 287.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|