C25H18N4O8S2 — CID 163415595
2-[4-[(E)-2-(2-methyl-4-nitrophenyl)ethenyl]-3-sulfophenyl]benzo[e]benzotriazole-7-sulfonic acid (PubChem CID 163415595) has the molecular formula C25H18N4O8S2 and a molecular weight of 566.57 g/mol. Its IUPAC name is 2-[4-[(E)-2-(2-methyl-4-nitrophenyl)ethenyl]-3-sulfophenyl]benzo[e]benzotriazole-7-sulfonic acid.
| Compound Name | 2-[4-[(E)-2-(2-methyl-4-nitrophenyl)ethenyl]-3-sulfophenyl]benzo[e]benzotriazole-7-sulfonic acid |
|---|---|
| PubChem CID | 163415595 |
| Molecular Formula | C25H18N4O8S2 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 2-[4-[(E)-2-(2-methyl-4-nitrophenyl)ethenyl]-3-sulfophenyl]benzo[e]benzotriazole-7-sulfonic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/C=C/c1ccc(-n2nc3ccc4cc(S(=O)(=O)O)ccc4c3n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C25H18N4O8S2/c1-15-12-20(29(30)31)8-4-16(15)2-3-17-5-7-19(14-24(17)39(35,36)37)28-26-23-11-6-18-13-21(38(32,33)34)9-10-22(18)25(23)27-28/h2-14H,1H3,(H,32,33,34)(H,35,36,37)/b3-2+ |
| InChIKey | AECNSUOHQBEMDH-NSCUHMNNSA-N |
| XLogP | 4.45 |
| TPSA | 182.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|