C17H13N3O4S — CID 102249844
6-hydroxy-5-(5-methylbenzotriazol-2-yl)naphthalene-2-sulfonic acid (PubChem CID 102249844) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is 6-hydroxy-5-(5-methylbenzotriazol-2-yl)naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-5-(5-methylbenzotriazol-2-yl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 102249844 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 6-hydroxy-5-(5-methylbenzotriazol-2-yl)naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc2nn(-c3c(O)ccc4cc(S(=O)(=O)O)ccc34)nc2c1 |
| InChI | InChI=1S/C17H13N3O4S/c1-10-2-6-14-15(8-10)19-20(18-14)17-13-5-4-12(25(22,23)24)9-11(13)3-7-16(17)21/h2-9,21H,1H3,(H,22,23,24) |
| InChIKey | HOCMMBRSJPUPRV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|