C15H15N3O4S — CID 22935695
5-ethyl-2-(2-hydroxy-5-methylphenyl)benzotriazole-4-sulfonic acid (PubChem CID 22935695) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 5-ethyl-2-(2-hydroxy-5-methylphenyl)benzotriazole-4-sulfonic acid.
| Compound Name | 5-ethyl-2-(2-hydroxy-5-methylphenyl)benzotriazole-4-sulfonic acid |
|---|---|
| PubChem CID | 22935695 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-ethyl-2-(2-hydroxy-5-methylphenyl)benzotriazole-4-sulfonic acid |
| SMILES | CCc1ccc2nn(-c3cc(C)ccc3O)nc2c1S(=O)(=O)O |
| InChI | InChI=1S/C15H15N3O4S/c1-3-10-5-6-11-14(15(10)23(20,21)22)17-18(16-11)12-8-9(2)4-7-13(12)19/h4-8,19H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | ULGLZNUEZFTTEC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|