C27H20N6O5 — CID 102195712
bis[2,4-dihydroxy-5-(5-methylbenzotriazol-2-yl)phenyl]methanone (PubChem CID 102195712) has the molecular formula C27H20N6O5 and a molecular weight of 508.49 g/mol. Its IUPAC name is bis[2,4-dihydroxy-5-(5-methylbenzotriazol-2-yl)phenyl]methanone.
| Compound Name | bis[2,4-dihydroxy-5-(5-methylbenzotriazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 102195712 |
| Molecular Formula | C27H20N6O5 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | bis[2,4-dihydroxy-5-(5-methylbenzotriazol-2-yl)phenyl]methanone |
| SMILES | Cc1ccc2nn(-c3cc(C(=O)c4cc(-n5nc6ccc(C)cc6n5)c(O)cc4O)c(O)cc3O)nc2c1 |
| InChI | InChI=1S/C27H20N6O5/c1-13-3-5-17-19(7-13)30-32(28-17)21-9-15(23(34)11-25(21)36)27(38)16-10-22(26(37)12-24(16)35)33-29-18-6-4-14(2)8-20(18)31-33/h3-12,34-37H,1-2H3 |
| InChIKey | RCELCPAZOCWRLV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |