C14H11N3O3 — CID 102011466
1-[5-(benzotriazol-2-yl)-2,4-dihydroxyphenyl]ethanone (PubChem CID 102011466) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-[5-(benzotriazol-2-yl)-2,4-dihydroxyphenyl]ethanone.
| Compound Name | 1-[5-(benzotriazol-2-yl)-2,4-dihydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 102011466 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[5-(benzotriazol-2-yl)-2,4-dihydroxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(-n2nc3ccccc3n2)c(O)cc1O |
| InChI | InChI=1S/C14H11N3O3/c1-8(18)9-6-12(14(20)7-13(9)19)17-15-10-4-2-3-5-11(10)16-17/h2-7,19-20H,1H3 |
| InChIKey | WGGHXAIUGCRJJW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |