C35H26N4O3 — CID 148944384
2-hydroxy-N-(4-methoxy-2-methylphenyl)-1-(naphthalen-1-yldiazenyl)-11H-benzo[a]carbazole-3-carboxamide (PubChem CID 148944384) has the molecular formula C35H26N4O3 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-hydroxy-N-(4-methoxy-2-methylphenyl)-1-(naphthalen-1-yldiazenyl)-11H-benzo[a]carbazole-3-carboxamide.
| Compound Name | 2-hydroxy-N-(4-methoxy-2-methylphenyl)-1-(naphthalen-1-yldiazenyl)-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| PubChem CID | 148944384 |
| Molecular Formula | C35H26N4O3 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-hydroxy-N-(4-methoxy-2-methylphenyl)-1-(naphthalen-1-yldiazenyl)-11H-benzo[a]carbazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccc4c5ccccc5[nH]c4c3c(/N=N/c3cccc4ccccc34)c2O)c(C)c1 |
| InChI | InChI=1S/C35H26N4O3/c1-20-18-23(42-2)15-17-28(20)37-35(41)27-19-22-14-16-26-25-11-5-6-12-29(25)36-32(26)31(22)33(34(27)40)39-38-30-13-7-9-21-8-3-4-10-24(21)30/h3-19,36,40H,1-2H3,(H,37,41)/b39-38+ |
| InChIKey | POQHZZFFIWSHGG-YMZYAJTMSA-N |
| XLogP | 9.32 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|