C39H26Cl4N6O3 — CID 136658590
ethane;2-hydroxy-N-phenyl-1-[[4-[(4,5,6,7-tetrachloro-3-oxoisoindol-1-ylidene)amino]phenyl]diazenyl]-11H-benzo[a]carbazole-3-carboxamide (PubChem CID 136658590) has the molecular formula C39H26Cl4N6O3 and a molecular weight of 768.49 g/mol. Its IUPAC name is ethane;2-hydroxy-N-phenyl-1-[[4-[(4,5,6,7-tetrachloro-3-oxoisoindol-1-ylidene)amino]phenyl]diazenyl]-11H-benzo[a]carbazole-3-carboxamide.
| Compound Name | ethane;2-hydroxy-N-phenyl-1-[[4-[(4,5,6,7-tetrachloro-3-oxoisoindol-1-ylidene)amino]phenyl]diazenyl]-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| PubChem CID | 136658590 |
| Molecular Formula | C39H26Cl4N6O3 |
| Molecular Weight | 768.49 g/mol |
| Exact Mass | 766.08 |
| IUPAC Name | ethane;2-hydroxy-N-phenyl-1-[[4-[(4,5,6,7-tetrachloro-3-oxoisoindol-1-ylidene)amino]phenyl]diazenyl]-11H-benzo[a]carbazole-3-carboxamide |
| SMILES | CC.O=C(Nc1ccccc1)c1cc2ccc3c4ccccc4[nH]c3c2c(/N=N/c2ccc(/N=C3\NC(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c43)cc2)c1O |
| InChI | InChI=1S/C37H20Cl4N6O3.C2H6/c38-28-26-27(29(39)31(41)30(28)40)37(50)45-35(26)42-19-11-13-20(14-12-19)46-47-33-25-17(10-15-22-21-8-4-5-9-24(21)44-32(22)25)16-23(34(33)48)36(49)43-18-6-2-1-3-7-18;1-2/h1-16,44,48H,(H,43,49)(H,42,45,50);1-2H3/b47-46+; |
| InChIKey | ZWJPJYAARMIFLG-VZGVLASBSA-N |
| XLogP | 12.31 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.49 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|