C39H27ClF3N5O5 — CID 136705063
3-[[3-[(4-benzamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-methoxybenzenecarboximidic acid (PubChem CID 136705063) has the molecular formula C39H27ClF3N5O5 and a molecular weight of 738.12 g/mol. Its IUPAC name is 3-[[3-[(4-benzamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-methoxybenzenecarboximidic acid.
| Compound Name | 3-[[3-[(4-benzamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-methoxybenzenecarboximidic acid |
|---|---|
| PubChem CID | 136705063 |
| Molecular Formula | C39H27ClF3N5O5 |
| Molecular Weight | 738.12 g/mol |
| Exact Mass | 737.17 |
| IUPAC Name | 3-[[3-[(4-benzamidophenyl)carbamoyl]-2-hydroxynaphthalen-1-yl]diazenyl]-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-methoxybenzenecarboximidic acid |
| SMILES | COc1ccc(/C(O)=N/c2cc(C(F)(F)F)ccc2Cl)cc1/N=N/c1c(O)c(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)cc2ccccc12 |
| InChI | InChI=1S/C39H27ClF3N5O5/c1-53-33-18-11-24(37(51)46-31-21-25(39(41,42)43)12-17-30(31)40)20-32(33)47-48-34-28-10-6-5-9-23(28)19-29(35(34)49)38(52)45-27-15-13-26(14-16-27)44-36(50)22-7-3-2-4-8-22/h2-21,49H,1H3,(H,44,50)(H,45,52)(H,46,51)/b48-47+ |
| InChIKey | PWVSVPMRPDQSJD-QJGAVIKSSA-N |
| XLogP | 10.78 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.12 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|