C32H25ClN4O4 — CID 136918743
N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid (PubChem CID 136918743) has the molecular formula C32H25ClN4O4 and a molecular weight of 565.03 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid |
|---|---|
| PubChem CID | 136918743 |
| Molecular Formula | C32H25ClN4O4 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-hydroxy-4-[[5-(C-hydroxy-N-phenylcarbonimidoyl)-2-methoxyphenyl]diazenyl]naphthalene-2-carboximidic acid |
| SMILES | COc1ccc(/C(O)=N/c2ccccc2)cc1/N=N/c1c(O)c(/C(O)=N/c2cc(Cl)ccc2C)cc2ccccc12 |
| InChI | InChI=1S/C32H25ClN4O4/c1-19-12-14-22(33)18-26(19)35-32(40)25-16-20-8-6-7-11-24(20)29(30(25)38)37-36-27-17-21(13-15-28(27)41-2)31(39)34-23-9-4-3-5-10-23/h3-18,38H,1-2H3,(H,34,39)(H,35,40)/b37-36+ |
| InChIKey | WWPCXBSKDSUELS-BSRQYYOTSA-N |
| XLogP | 9.20 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|