C30H24N2O9 — CID 138401006
4-[(4-aminophenyl)methyl]aniline;4-(3,4-dicarboxybenzoyl)phthalic acid (PubChem CID 138401006) has the molecular formula C30H24N2O9 and a molecular weight of 556.53 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;4-(3,4-dicarboxybenzoyl)phthalic acid.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;4-(3,4-dicarboxybenzoyl)phthalic acid |
|---|---|
| PubChem CID | 138401006 |
| Molecular Formula | C30H24N2O9 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;4-(3,4-dicarboxybenzoyl)phthalic acid |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.O=C(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H10O9.C13H14N2/c18-13(7-1-3-9(14(19)20)11(5-7)16(23)24)8-2-4-10(15(21)22)12(6-8)17(25)26;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26);1-8H,9,14-15H2 |
| InChIKey | JIGWKLSFONMHKI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|