C25H24Cl4N2O11 — CID 67650457
4-(3,4-dicarboxybenzoyl)phthalic acid;bis(2,2-dichlorobutanamide) (PubChem CID 67650457) has the molecular formula C25H24Cl4N2O11 and a molecular weight of 670.28 g/mol. Its IUPAC name is 4-(3,4-dicarboxybenzoyl)phthalic acid;bis(2,2-dichlorobutanamide).
| Compound Name | 4-(3,4-dicarboxybenzoyl)phthalic acid;bis(2,2-dichlorobutanamide) |
|---|---|
| PubChem CID | 67650457 |
| Molecular Formula | C25H24Cl4N2O11 |
| Molecular Weight | 670.28 g/mol |
| Exact Mass | 668.01 |
| IUPAC Name | 4-(3,4-dicarboxybenzoyl)phthalic acid;bis(2,2-dichlorobutanamide) |
| SMILES | CCC(Cl)(Cl)C(N)=O.CCC(Cl)(Cl)C(N)=O.O=C(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H10O9.2C4H7Cl2NO/c18-13(7-1-3-9(14(19)20)11(5-7)16(23)24)8-2-4-10(15(21)22)12(6-8)17(25)26;2*1-2-4(5,6)3(7)8/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26);2*2H2,1H3,(H2,7,8) |
| InChIKey | XQQXZCWAXXWDMH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 252.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|