C34H32N2O9 — CID 71310713
4-[(4-aminophenyl)methyl]aniline;4-(4-carboxy-3-ethoxycarbonylbenzoyl)-2-ethoxycarbonylbenzoic acid (PubChem CID 71310713) has the molecular formula C34H32N2O9 and a molecular weight of 612.63 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;4-(4-carboxy-3-ethoxycarbonylbenzoyl)-2-ethoxycarbonylbenzoic acid.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;4-(4-carboxy-3-ethoxycarbonylbenzoyl)-2-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 71310713 |
| Molecular Formula | C34H32N2O9 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;4-(4-carboxy-3-ethoxycarbonylbenzoyl)-2-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cc(C(=O)c2ccc(C(=O)O)c(C(=O)OCC)c2)ccc1C(=O)O.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H18O9.C13H14N2/c1-3-29-20(27)15-9-11(5-7-13(15)18(23)24)17(22)12-6-8-14(19(25)26)16(10-12)21(28)30-4-2;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h5-10H,3-4H2,1-2H3,(H,23,24)(H,25,26);1-8H,9,14-15H2 |
| InChIKey | QXGBOTBZAQZGQY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 196.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|