C19H14O10 — CID 134587594
4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid (PubChem CID 134587594) has the molecular formula C19H14O10 and a molecular weight of 402.31 g/mol. Its IUPAC name is 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid.
| Compound Name | 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid |
|---|---|
| PubChem CID | 134587594 |
| Molecular Formula | C19H14O10 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid |
| SMILES | O=C(O)CC(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H14O10/c20-15(21)7-12(8-1-3-10(16(22)23)13(5-8)18(26)27)9-2-4-11(17(24)25)14(6-9)19(28)29/h1-6,12H,7H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | KMVNOFBMDODRRX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |