4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid

C19H14O10 — CID 134587594

IUPAC4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid
SMILESO=C(O)CC(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C19H14O10/c20-15(21)7-12(8-1-3-10(16(22)23)13(5-8)18(26)27)9-2-4-11(17(24)25)14(6-9)19(28)29/h1-6,12H,7H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)
InChIKeyKMVNOFBMDODRRX-UHFFFAOYSA-N
MW402.31 g/mol
LogP2.09
Rot. Bonds8

About 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid

4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid (PubChem CID 134587594) has the molecular formula C19H14O10 and a molecular weight of 402.31 g/mol. Its IUPAC name is 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid.

Molecular Properties

Compound Name4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid
PubChem CID134587594
Molecular FormulaC19H14O10
Molecular Weight402.31 g/mol
Exact Mass402.06
IUPAC Name4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid
SMILESO=C(O)CC(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C19H14O10/c20-15(21)7-12(8-1-3-10(16(22)23)13(5-8)18(26)27)9-2-4-11(17(24)25)14(6-9)19(28)29/h1-6,12H,7H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)
InChIKeyKMVNOFBMDODRRX-UHFFFAOYSA-N
XLogP2.09
TPSA186.50 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500402.31
LogP ≤ 52.09
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid?
The IUPAC name of 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid (CID 134587594) is 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid.
What is the SMILES notation for 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid?
The canonical SMILES for 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid is O=C(O)CC(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid?
The InChIKey is KMVNOFBMDODRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O10/c20-15(21)7-12(8-1-3-10(16(22)23)13(5-8)18(26)27)9-2-4-11(17(24)25)14(6-9)19(28)29/h1-6,12H,7H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29).
What are the key properties of 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid?
4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid has a molecular weight of 402.31 g/mol, XLogP of 2.09, 8 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-carboxy-1-(3,4-dicarboxyphenyl)ethyl]phthalic acid is sourced from PubChem (CID 134587594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).