C22H36ClNO2 — CID 20536446
3-chloro-4-(3,7,11-trimethyldodecylamino)benzoic acid (PubChem CID 20536446) has the molecular formula C22H36ClNO2 and a molecular weight of 381.99 g/mol. Its IUPAC name is 3-chloro-4-(3,7,11-trimethyldodecylamino)benzoic acid.
| Compound Name | 3-chloro-4-(3,7,11-trimethyldodecylamino)benzoic acid |
|---|---|
| PubChem CID | 20536446 |
| Molecular Formula | C22H36ClNO2 |
| Molecular Weight | 381.99 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 3-chloro-4-(3,7,11-trimethyldodecylamino)benzoic acid |
| SMILES | CC(C)CCCC(C)CCCC(C)CCNc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C22H36ClNO2/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-24-21-12-11-19(22(25)26)15-20(21)23/h11-12,15-18,24H,5-10,13-14H2,1-4H3,(H,25,26) |
| InChIKey | IASKARGPCZSDMJ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.99 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |