C32H30O4 — CID 86067047
9,9-bis(2-phenylmethoxyethyl)fluorene-2-carboxylic acid (PubChem CID 86067047) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 9,9-bis(2-phenylmethoxyethyl)fluorene-2-carboxylic acid.
| Compound Name | 9,9-bis(2-phenylmethoxyethyl)fluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 86067047 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 9,9-bis(2-phenylmethoxyethyl)fluorene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(CCOCc1ccccc1)(CCOCc1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C32H30O4/c33-31(34)26-15-16-28-27-13-7-8-14-29(27)32(30(28)21-26,17-19-35-22-24-9-3-1-4-10-24)18-20-36-23-25-11-5-2-6-12-25/h1-16,21H,17-20,22-23H2,(H,33,34) |
| InChIKey | QKRLHLAJXUDJQC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|