C24H27N3O4S — CID 110590386
ethyl 4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 110590386) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110590386 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | ethyl 4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(Nc3cccc(C)c3C)=C(c3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C24H27N3O4S/c1-4-31-24(30)26-12-10-17(11-13-26)27-22(28)20(19-9-6-14-32-19)21(23(27)29)25-18-8-5-7-15(2)16(18)3/h5-9,14,17,25H,4,10-13H2,1-3H3 |
| InChIKey | JILJKQFDMMGAAF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|