C29H35N3O2 — CID 110578689
3-(4-benzylpiperazin-1-yl)-1-cyclohexyl-4-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110578689) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-1-cyclohexyl-4-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-1-cyclohexyl-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578689 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-1-cyclohexyl-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(Cc4ccccc4)CC3)C(=O)N(C3CCCCC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C29H35N3O2/c1-21-13-14-25(22(2)19-21)26-27(29(34)32(28(26)33)24-11-7-4-8-12-24)31-17-15-30(16-18-31)20-23-9-5-3-6-10-23/h3,5-6,9-10,13-14,19,24H,4,7-8,11-12,15-18,20H2,1-2H3 |
| InChIKey | VOFPZLWXMSGNTQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|