C27H32N4O2 — CID 110558575
1-(1-benzylpiperidin-4-yl)-3-(4-methylpiperazin-1-yl)-4-phenylpyrrole-2,5-dione (PubChem CID 110558575) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(4-methylpiperazin-1-yl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(4-methylpiperazin-1-yl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558575 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(4-methylpiperazin-1-yl)-4-phenylpyrrole-2,5-dione |
| SMILES | CN1CCN(C2=C(c3ccccc3)C(=O)N(C3CCN(Cc4ccccc4)CC3)C2=O)CC1 |
| InChI | InChI=1S/C27H32N4O2/c1-28-16-18-30(19-17-28)25-24(22-10-6-3-7-11-22)26(32)31(27(25)33)23-12-14-29(15-13-23)20-21-8-4-2-5-9-21/h2-11,23H,12-20H2,1H3 |
| InChIKey | RLYLGTJQXZAXAV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|