C24H24Cl2N2O2 — CID 110569140
3-(4-chlorophenyl)-1-[2-(4-chlorophenyl)ethyl]-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110569140) has the molecular formula C24H24Cl2N2O2 and a molecular weight of 443.37 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-(4-chlorophenyl)ethyl]-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[2-(4-chlorophenyl)ethyl]-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569140 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-(4-chlorophenyl)ethyl]-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | CC1CCCN(C2=C(c3ccc(Cl)cc3)C(=O)N(CCc3ccc(Cl)cc3)C2=O)C1 |
| InChI | InChI=1S/C24H24Cl2N2O2/c1-16-3-2-13-27(15-16)22-21(18-6-10-20(26)11-7-18)23(29)28(24(22)30)14-12-17-4-8-19(25)9-5-17/h4-11,16H,2-3,12-15H2,1H3 |
| InChIKey | MQWHYEQSEWIPQO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|