C25H27ClN2O2 — CID 110578103
1-[(4-chlorophenyl)methyl]-3-(2,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110578103) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578103 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCCC(C)C3)C(=O)N(Cc3ccc(Cl)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C25H27ClN2O2/c1-16-6-11-21(18(3)13-16)22-23(27-12-4-5-17(2)14-27)25(30)28(24(22)29)15-19-7-9-20(26)10-8-19/h6-11,13,17H,4-5,12,14-15H2,1-3H3 |
| InChIKey | LINMHLYSUNUWID-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|