C25H29N3O2 — CID 110578306
3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione (PubChem CID 110578306) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578306 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)CC(C)C3)C(=O)N(Cc3cccnc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C25H29N3O2/c1-16-7-8-21(19(4)11-16)22-23(27-13-17(2)10-18(3)14-27)25(30)28(24(22)29)15-20-6-5-9-26-12-20/h5-9,11-12,17-18H,10,13-15H2,1-4H3 |
| InChIKey | XVXBKKWCKZWQOC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|