C25H25N3O2 — CID 110550717
4-[3-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110550717) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110550717 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | Cc1ccc(C2=C(N3CCCC(C)C3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1C |
| InChI | InChI=1S/C25H25N3O2/c1-16-5-4-12-27(15-16)23-22(20-9-6-17(2)18(3)13-20)24(29)28(25(23)30)21-10-7-19(14-26)8-11-21/h6-11,13,16H,4-5,12,15H2,1-3H3 |
| InChIKey | SLZGUWJFJGRQNY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|