C21H18Cl2N2O2 — CID 110584051
3-chloro-4-(4-chlorophenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione (PubChem CID 110584051) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 3-chloro-4-(4-chlorophenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-chlorophenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584051 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-chloro-4-(4-chlorophenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(c2ccc(Cl)cc2)C(=O)N1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O2/c22-15-6-4-14(5-7-15)18-19(23)21(27)25(20(18)26)17-10-8-16(9-11-17)24-12-2-1-3-13-24/h4-11H,1-3,12-13H2 |
| InChIKey | IKLQUGHMICDRDD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|