C24H25ClN2O2 — CID 110570891
1-(4-tert-butylphenyl)-3-(4-chlorophenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 110570891) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-chlorophenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-chlorophenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110570891 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-chlorophenyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | CC(C)(C)c1ccc(N2C(=O)C(c3ccc(Cl)cc3)=C(N3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H25ClN2O2/c1-24(2,3)17-8-12-19(13-9-17)27-22(28)20(16-6-10-18(25)11-7-16)21(23(27)29)26-14-4-5-15-26/h6-13H,4-5,14-15H2,1-3H3 |
| InChIKey | SFHORFKVFRLADL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|