C26H31N3O2 — CID 110574028
1-(4-tert-butylphenyl)-3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110574028) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110574028 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(C)CC3)C(=O)N(c3ccc(C(C)(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-18-6-8-19(9-7-18)22-23(28-16-14-27(5)15-17-28)25(31)29(24(22)30)21-12-10-20(11-13-21)26(2,3)4/h6-13H,14-17H2,1-5H3 |
| InChIKey | YQXRGEXZVKHFCI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|