C22H21ClN2O3 — CID 110583148
3-chloro-4-(4-methoxyphenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione (PubChem CID 110583148) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 3-chloro-4-(4-methoxyphenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-methoxyphenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583148 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-chloro-4-(4-methoxyphenyl)-1-(4-piperidin-1-ylphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Cl)C(=O)N(c3ccc(N4CCCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-28-18-11-5-15(6-12-18)19-20(23)22(27)25(21(19)26)17-9-7-16(8-10-17)24-13-3-2-4-14-24/h5-12H,2-4,13-14H2,1H3 |
| InChIKey | BKNYUPUZVNEREM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|