C18H15ClN2O3S — CID 68544081
(3aR,4S,7R,7aS)-2-[3-chloro-4-(1,3-thiazol-2-yl)phenyl]-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 68544081) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-[3-chloro-4-(1,3-thiazol-2-yl)phenyl]-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-[3-chloro-4-(1,3-thiazol-2-yl)phenyl]-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 68544081 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-[3-chloro-4-(1,3-thiazol-2-yl)phenyl]-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12CC[C@H](O1)[C@@H]1C(=O)N(c3ccc(-c4nccs4)c(Cl)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-18-5-4-12(24-18)13-14(18)17(23)21(16(13)22)9-2-3-10(11(19)8-9)15-20-6-7-25-15/h2-3,6-8,12-14H,4-5H2,1H3/t12-,13-,14+,18+/m0/s1 |
| InChIKey | RAJDQSQJRBGGRX-UYAYXHRUSA-N |
| XLogP | 3.52 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|