C12H12N2O3S — CID 622006
ethyl 4-(2-imino-4-oxo-1,3-thiazolidin-3-yl)benzoate (PubChem CID 622006) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is ethyl 4-(2-imino-4-oxo-1,3-thiazolidin-3-yl)benzoate.
| Compound Name | ethyl 4-(2-imino-4-oxo-1,3-thiazolidin-3-yl)benzoate |
|---|---|
| PubChem CID | 622006 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | ethyl 4-(2-imino-4-oxo-1,3-thiazolidin-3-yl)benzoate |
| SMILES | [H]/N=C1\SCC(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-17-11(16)8-3-5-9(6-4-8)14-10(15)7-18-12(14)13/h3-6,13H,2,7H2,1H3/b13-12- |
| InChIKey | BJPPIMKIMFWYAK-SEYXRHQNSA-N |
| XLogP | 1.88 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|