C22H23N3O4S — CID 99806127
ethyl 4-[[2-[(5R)-3-(4-ethylphenyl)-2-imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 99806127) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is ethyl 4-[[2-[(5R)-3-(4-ethylphenyl)-2-imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(5R)-3-(4-ethylphenyl)-2-imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 99806127 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | ethyl 4-[[2-[(5R)-3-(4-ethylphenyl)-2-imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | [H]/N=C1\S[C@H](CC(=O)Nc2ccc(C(=O)OCC)cc2)C(=O)N1c1ccc(CC)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-3-14-5-11-17(12-6-14)25-20(27)18(30-22(25)23)13-19(26)24-16-9-7-15(8-10-16)21(28)29-4-2/h5-12,18,23H,3-4,13H2,1-2H3,(H,24,26)/b23-22-/t18-/m1/s1 |
| InChIKey | MDKVWEDSOGHXPJ-LINNUKDLSA-N |
| XLogP | 3.84 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|