C22H22N2O6S — CID 1227090
ethyl 4-[2-imino-4-oxo-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate (PubChem CID 1227090) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is ethyl 4-[2-imino-4-oxo-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[2-imino-4-oxo-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 1227090 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 4-[2-imino-4-oxo-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate |
| SMILES | [H]/N=C1\SC(=Cc2ccc(OC)c(OC)c2OC)C(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-5-30-21(26)13-6-9-15(10-7-13)24-20(25)17(31-22(24)23)12-14-8-11-16(27-2)19(29-4)18(14)28-3/h6-12,23H,5H2,1-4H3/b17-12?,23-22- |
| InChIKey | MFHWCNQQTBGTMX-AKOWGPFBSA-N |
| XLogP | 3.94 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|